C4H6 — CID 58066887
3,3,4,4,4-pentadeuteriobut-1-yne (PubChem CID 58066887) has the molecular formula C4H6 and a molecular weight of 59.12 g/mol. Its IUPAC name is 3,3,4,4,4-pentadeuteriobut-1-yne.
| Compound Name | 3,3,4,4,4-pentadeuteriobut-1-yne |
|---|---|
| PubChem CID | 58066887 |
| Molecular Formula | C4H6 |
| Molecular Weight | 59.12 g/mol |
| Exact Mass | 59.08 |
| IUPAC Name | 3,3,4,4,4-pentadeuteriobut-1-yne |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C#C |
| InChI | InChI=1S/C4H6/c1-3-4-2/h1H,4H2,2H3/i2D3,4D2 |
| InChIKey | KDKYADYSIPSCCQ-PVGOWFQYSA-N |
| XLogP | 1.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 59.12 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|