About 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide
12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide (PubChem CID 58066928) has the molecular formula C17H26N2O4
and a molecular weight of 322.40 g/mol. Its IUPAC name is 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide.
Molecular Properties
| Compound Name | 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide |
| PubChem CID | 58066928 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide |
| SMILES | CNC(=O)CCCCCCCCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H26N2O4/c1-18-15(21)9-7-5-3-2-4-6-8-14(20)12-13-19-16(22)10-11-17(19)23/h10-11H,2-9,12-13H2,1H3,(H,18,21) |
| InChIKey | VXQBLJYUVZJQSA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide?
The IUPAC name of 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide (CID 58066928) is 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide.
What is the SMILES notation for 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide?
The canonical SMILES for 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide is CNC(=O)CCCCCCCCC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide?
The InChIKey is VXQBLJYUVZJQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-18-15(21)9-7-5-3-2-4-6-8-14(20)12-13-19-16(22)10-11-17(19)23/h10-11H,2-9,12-13H2,1H3,(H,18,21).
What are the key properties of 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide?
12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide has a molecular weight of 322.40 g/mol, XLogP of 1.74, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(2,5-dioxopyrrol-1-yl)-N-methyl-10-oxododecanamide is sourced from PubChem (CID 58066928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).