About 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate
1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate (PubChem CID 58067068) has the molecular formula C11H18O4
and a molecular weight of 216.27 g/mol. Its IUPAC name is 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate.
Molecular Properties
| Compound Name | 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate |
| PubChem CID | 58067068 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate |
| SMILES | [3H]C(C)OC(=O)C1(CCC(C)C)CC(=O)O1 |
| InChI | InChI=1S/C11H18O4/c1-4-14-10(13)11(6-5-8(2)3)7-9(12)15-11/h8H,4-7H2,1-3H3/i4T |
| InChIKey | KBNLGXPRNKAGRR-IBTRZKOZSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate?
The IUPAC name of 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate (CID 58067068) is 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate.
What is the SMILES notation for 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate?
The canonical SMILES for 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate is [3H]C(C)OC(=O)C1(CCC(C)C)CC(=O)O1.
What is the InChIKey of 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate?
The InChIKey is KBNLGXPRNKAGRR-IBTRZKOZSA-N. The full InChI is InChI=1S/C11H18O4/c1-4-14-10(13)11(6-5-8(2)3)7-9(12)15-11/h8H,4-7H2,1-3H3/i4T.
What are the key properties of 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate?
1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate has a molecular weight of 216.27 g/mol, XLogP of 1.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tritioethyl 2-(3-methylbutyl)-4-oxooxetane-2-carboxylate is sourced from PubChem (CID 58067068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).