C16H31O2P — CID 58067314
9-tert-butyl-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane (PubChem CID 58067314) has the molecular formula C16H31O2P and a molecular weight of 286.40 g/mol. Its IUPAC name is 9-tert-butyl-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 58067314 |
| Molecular Formula | C16H31O2P |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 9-tert-butyl-8,8,10,10-tetramethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
| SMILES | CC(C)(C)P1C(C)(C)CC2(CC1(C)C)OCCCO2 |
| InChI | InChI=1S/C16H31O2P/c1-13(2,3)19-14(4,5)11-16(12-15(19,6)7)17-9-8-10-18-16/h8-12H2,1-7H3 |
| InChIKey | BZVACQRKZYEEFR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|