About 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone
1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone (PubChem CID 58067410) has the molecular formula C20H17N3O2S
and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone |
| PubChem CID | 58067410 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone |
| SMILES | CN(C)c1ccc(C(=O)Cc2ccc(-c3nc4cnccc4o3)s2)cc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-23(2)14-5-3-13(4-6-14)17(24)11-15-7-8-19(26-15)20-22-16-12-21-10-9-18(16)25-20/h3-10,12H,11H2,1-2H3 |
| InChIKey | RDDMWBBNXFKZNF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone?
The IUPAC name of 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone (CID 58067410) is 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone.
What is the SMILES notation for 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone?
The canonical SMILES for 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone is CN(C)c1ccc(C(=O)Cc2ccc(-c3nc4cnccc4o3)s2)cc1.
What is the InChIKey of 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone?
The InChIKey is RDDMWBBNXFKZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2S/c1-23(2)14-5-3-13(4-6-14)17(24)11-15-7-8-19(26-15)20-22-16-12-21-10-9-18(16)25-20/h3-10,12H,11H2,1-2H3.
What are the key properties of 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone?
1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone has a molecular weight of 363.44 g/mol, XLogP of 4.44, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(dimethylamino)phenyl]-2-[5-([1,3]oxazolo[4,5-c]pyridin-2-yl)thiophen-2-yl]ethanone is sourced from PubChem (CID 58067410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).