C14H22O — CID 58067883
(3aR,4R,7S)-4-methyl-7-(2-methylprop-1-enyl)-2,3,3a,4,5,6,7,7a-octahydroinden-1-one (PubChem CID 58067883) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (3aR,4R,7S)-4-methyl-7-(2-methylprop-1-enyl)-2,3,3a,4,5,6,7,7a-octahydroinden-1-one.
| Compound Name | (3aR,4R,7S)-4-methyl-7-(2-methylprop-1-enyl)-2,3,3a,4,5,6,7,7a-octahydroinden-1-one |
|---|---|
| PubChem CID | 58067883 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (3aR,4R,7S)-4-methyl-7-(2-methylprop-1-enyl)-2,3,3a,4,5,6,7,7a-octahydroinden-1-one |
| SMILES | CC(C)=C[C@@H]1CC[C@@H](C)[C@H]2CCC(=O)C12 |
| InChI | InChI=1S/C14H22O/c1-9(2)8-11-5-4-10(3)12-6-7-13(15)14(11)12/h8,10-12,14H,4-7H2,1-3H3/t10-,11+,12-,14?/m1/s1 |
| InChIKey | QHSIVJRINQDVGY-JIROBOQZSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|