C78H45N3S — CID 58068416
3-[4-[2,8-Bis(9,9'-spirobi[fluorene]-2-yl)dibenzothiophen-4-yl]phenyl]-[1,2,4]triazolo[3,4-a]isoquinoline (PubChem CID 58068416) has the molecular formula C78H45N3S and a molecular weight of 1056.30 g/mol. Its IUPAC name is 3-[4-[2,8-bis(9,9'-spirobi[fluorene]-2-yl)dibenzothiophen-4-yl]phenyl]-[1,2,4]triazolo[3,4-a]isoquinoline.
| Compound Name | 3-[4-[2,8-Bis(9,9'-spirobi[fluorene]-2-yl)dibenzothiophen-4-yl]phenyl]-[1,2,4]triazolo[3,4-a]isoquinoline |
|---|---|
| PubChem CID | 58068416 |
| Molecular Formula | C78H45N3S |
| Molecular Weight | 1056.30 g/mol |
| Exact Mass | 1055.33 |
| IUPAC Name | 3-[4-[2,8-bis(9,9'-spirobi[fluorene]-2-yl)dibenzothiophen-4-yl]phenyl]-[1,2,4]triazolo[3,4-a]isoquinoline |
| SMILES | C1=CC=C2C(=C1)C=CN3C2=NN=C3C4=CC=C(C=C4)C5=CC(=CC6=C5SC7=C6C=C(C=C7)C8=CC9=C(C=C8)C1=CC=CC=C1C91C2=CC=CC=C2C2=CC=CC=C12)C1=CC2=C(C=C1)C1=CC=CC=C1C21C2=CC=CC=C2C2=CC=CC=C12 |
| InChI | InChI=1S/C78H45N3S/c1-2-16-53-46(15-1)39-40-81-75(79-80-76(53)81)48-31-29-47(30-32-48)62-42-52(51-34-37-61-59-22-8-14-28-70(59)78(72(61)45-51)67-25-11-5-19-56(67)57-20-6-12-26-68(57)78)43-64-63-41-49(35-38-73(63)82-74(62)64)50-33-36-60-58-21-7-13-27-69(58)77(71(60)44-50)65-23-9-3-17-54(65)55-18-4-10-24-66(55)77/h1-45H |
| InChIKey | CVJSGUVYADHEOW-UHFFFAOYSA-N |
| XLogP | 20.20 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 82 |
| Complexity | 2240 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.30 |
| LogP ≤ 5 | 20.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |