C22H16BrN3 — CID 58068576
3-(4-bromophenyl)-7-ethyl-[1,2,4]triazolo[4,3-f]phenanthridine (PubChem CID 58068576) has the molecular formula C22H16BrN3 and a molecular weight of 402.30 g/mol. Its IUPAC name is 3-(4-bromophenyl)-7-ethyl-[1,2,4]triazolo[4,3-f]phenanthridine.
| Compound Name | 3-(4-bromophenyl)-7-ethyl-[1,2,4]triazolo[4,3-f]phenanthridine |
|---|---|
| PubChem CID | 58068576 |
| Molecular Formula | C22H16BrN3 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 3-(4-bromophenyl)-7-ethyl-[1,2,4]triazolo[4,3-f]phenanthridine |
| SMILES | CCc1ccc2c(c1)c1ccccc1c1nnc(-c3ccc(Br)cc3)n21 |
| InChI | InChI=1S/C22H16BrN3/c1-2-14-7-12-20-19(13-14)17-5-3-4-6-18(17)22-25-24-21(26(20)22)15-8-10-16(23)11-9-15/h3-13H,2H2,1H3 |
| InChIKey | BBVKDWBQGURBSF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|