About 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline
3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline (PubChem CID 58068644) has the molecular formula C28H18BrN3
and a molecular weight of 476.38 g/mol. Its IUPAC name is 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline |
| PubChem CID | 58068644 |
| Molecular Formula | C28H18BrN3 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline |
| SMILES | Brc1ccc(-c2nnc3c4ccccc4c(-c4ccc(-c5ccccc5)cc4)cn23)cc1 |
| InChI | InChI=1S/C28H18BrN3/c29-23-16-14-22(15-17-23)27-30-31-28-25-9-5-4-8-24(25)26(18-32(27)28)21-12-10-20(11-13-21)19-6-2-1-3-7-19/h1-18H |
| InChIKey | PZUDEEYFGMGAAT-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline?
The IUPAC name of 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline (CID 58068644) is 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline.
What is the SMILES notation for 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline?
The canonical SMILES for 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline is Brc1ccc(-c2nnc3c4ccccc4c(-c4ccc(-c5ccccc5)cc4)cn23)cc1.
What is the InChIKey of 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline?
The InChIKey is PZUDEEYFGMGAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18BrN3/c29-23-16-14-22(15-17-23)27-30-31-28-25-9-5-4-8-24(25)26(18-32(27)28)21-12-10-20(11-13-21)19-6-2-1-3-7-19/h1-18H.
What are the key properties of 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline?
3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline has a molecular weight of 476.38 g/mol, XLogP of 7.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-6-(4-phenylphenyl)-[1,2,4]triazolo[3,4-a]isoquinoline is sourced from PubChem (CID 58068644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).