C28H32N4O3 — CID 58069339
1-ethyl-6-(3-morpholin-4-ylpropoxy)-2-[3-(2-oxopyrrolidin-1-yl)phenyl]indole-3-carbonitrile (PubChem CID 58069339) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-ethyl-6-(3-morpholin-4-ylpropoxy)-2-[3-(2-oxopyrrolidin-1-yl)phenyl]indole-3-carbonitrile.
| Compound Name | 1-ethyl-6-(3-morpholin-4-ylpropoxy)-2-[3-(2-oxopyrrolidin-1-yl)phenyl]indole-3-carbonitrile |
|---|---|
| PubChem CID | 58069339 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 1-ethyl-6-(3-morpholin-4-ylpropoxy)-2-[3-(2-oxopyrrolidin-1-yl)phenyl]indole-3-carbonitrile |
| SMILES | CCn1c(-c2cccc(N3CCCC3=O)c2)c(C#N)c2ccc(OCCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C28H32N4O3/c1-2-31-26-19-23(35-15-5-11-30-13-16-34-17-14-30)9-10-24(26)25(20-29)28(31)21-6-3-7-22(18-21)32-12-4-8-27(32)33/h3,6-7,9-10,18-19H,2,4-5,8,11-17H2,1H3 |
| InChIKey | IIOZZOHPLIAKRK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|