C13H16FN4O12P3 — CID 58069394
[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 58069394) has the molecular formula C13H16FN4O12P3 and a molecular weight of 532.21 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58069394 |
| Molecular Formula | C13H16FN4O12P3 |
| Molecular Weight | 532.21 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ccnn23)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C13H16FN4O12P3/c14-12-11(19)9(5-27-32(23,24)30-33(25,26)29-31(20,21)22)28-13(12,6-15)10-2-1-8-7(16)3-4-17-18(8)10/h1-4,9,11-12,19H,5,16H2,(H,23,24)(H,25,26)(H2,20,21,22)/t9-,11-,12-,13+/m1/s1 |
| InChIKey | IESAIQOJFNINAM-JHEVNIALSA-N |
| XLogP | 0.08 |
| TPSA | 256.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|