C13H19FN3O12P3 — CID 58069398
[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 58069398) has the molecular formula C13H19FN3O12P3 and a molecular weight of 521.22 g/mol. Its IUPAC name is [[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58069398 |
| Molecular Formula | C13H19FN3O12P3 |
| Molecular Weight | 521.22 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | [[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(c2ccc3c(N)ccnn23)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C13H19FN3O12P3/c1-13(10-3-2-8-7(15)4-5-16-17(8)10)12(14)11(18)9(27-13)6-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-5,9,11-12,18H,6,15H2,1H3,(H,22,23)(H,24,25)(H2,19,20,21)/t9-,11-,12-,13+/m1/s1 |
| InChIKey | UVXIEXRMUUYOLX-JHEVNIALSA-N |
| XLogP | 0.57 |
| TPSA | 232.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|