C24H30FN4O7P — CID 58069406
ethyl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 58069406) has the molecular formula C24H30FN4O7P and a molecular weight of 536.50 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58069406 |
| Molecular Formula | C24H30FN4O7P |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | ethyl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ccnn23)[C@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H30FN4O7P/c1-4-33-23(31)15(2)28-37(32,36-16-8-6-5-7-9-16)34-14-19-21(30)22(25)24(3,35-19)20-11-10-18-17(26)12-13-27-29(18)20/h5-13,15,19,21-22,30H,4,14,26H2,1-3H3,(H,28,32)/t15-,19-,21-,22-,24+,37?/m1/s1 |
| InChIKey | ITVATRGTVVJIGW-PCGGUIEYSA-N |
| XLogP | 2.97 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|