C42H80N4 — CID 58069504
2-[2-[methyl-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]amino]ethyl]guanidine (PubChem CID 58069504) has the molecular formula C42H80N4 and a molecular weight of 641.13 g/mol. Its IUPAC name is 2-[2-[methyl-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[methyl-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 58069504 |
| Molecular Formula | C42H80N4 |
| Molecular Weight | 641.13 g/mol |
| Exact Mass | 640.64 |
| IUPAC Name | 2-[2-[methyl-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]amino]ethyl]guanidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CN(C)CCN=C(N)N |
| InChI | InChI=1S/C42H80N4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(40-46(3)39-38-45-42(43)44)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41H,4-11,16-17,22-40H2,1-3H3,(H4,43,44,45)/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | FJODNHGOBDWIHG-QYCRHRGJSA-N |
| XLogP | 12.22 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.13 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|