C39H73N — CID 58069533
(11Z,14Z)-N-methyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-amine (PubChem CID 58069533) has the molecular formula C39H73N and a molecular weight of 556.02 g/mol. Its IUPAC name is (11Z,14Z)-N-methyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-amine.
| Compound Name | (11Z,14Z)-N-methyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-amine |
|---|---|
| PubChem CID | 58069533 |
| Molecular Formula | C39H73N |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.57 |
| IUPAC Name | (11Z,14Z)-N-methyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CNC |
| InChI | InChI=1S/C39H73N/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39(38-40-3)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,39-40H,4-11,16-17,22-38H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | DLVBXZWONTUXAN-QYCRHRGJSA-N |
| XLogP | 13.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|