C40H72O2 — CID 58069555
(4S)-4-methyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane (PubChem CID 58069555) has the molecular formula C40H72O2 and a molecular weight of 585.01 g/mol. Its IUPAC name is (4S)-4-methyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane.
| Compound Name | (4S)-4-methyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 58069555 |
| Molecular Formula | C40H72O2 |
| Molecular Weight | 585.01 g/mol |
| Exact Mass | 584.55 |
| IUPAC Name | (4S)-4-methyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC[C@H](C)O1 |
| InChI | InChI=1S/C40H72O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40(41-38-39(3)42-40)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,39H,4-11,16-17,22-38H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t39-/m0/s1 |
| InChIKey | QFTYAAIKYAOJGV-LAFHUPOYSA-N |
| XLogP | 13.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.01 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|