C42H76O2 — CID 58069594
(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4-propyl-1,3-dioxolane (PubChem CID 58069594) has the molecular formula C42H76O2 and a molecular weight of 613.07 g/mol. Its IUPAC name is (4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4-propyl-1,3-dioxolane.
| Compound Name | (4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 58069594 |
| Molecular Formula | C42H76O2 |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.58 |
| IUPAC Name | (4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4-propyl-1,3-dioxolane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC[C@H](CCC)O1 |
| InChI | InChI=1S/C42H76O2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-42(43-40-41(44-42)37-6-3)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,41H,4-12,17-18,23-40H2,1-3H3/b15-13-,16-14-,21-19-,22-20-/t41-/m0/s1 |
| InChIKey | WOWNOFZJGRBAER-DEJAJOLASA-N |
| XLogP | 14.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|