C39H68O2 — CID 58069625
2-[(5Z,8Z,11Z)-hexadeca-5,8,11-trienyl]-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane (PubChem CID 58069625) has the molecular formula C39H68O2 and a molecular weight of 568.97 g/mol. Its IUPAC name is 2-[(5Z,8Z,11Z)-hexadeca-5,8,11-trienyl]-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane.
| Compound Name | 2-[(5Z,8Z,11Z)-hexadeca-5,8,11-trienyl]-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 58069625 |
| Molecular Formula | C39H68O2 |
| Molecular Weight | 568.97 g/mol |
| Exact Mass | 568.52 |
| IUPAC Name | 2-[(5Z,8Z,11Z)-hexadeca-5,8,11-trienyl]-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
| SMILES | CCCC/C=C\C/C=C\C/C=C\CCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC(C)C(C)O1 |
| InChI | InChI=1S/C39H68O2/c1-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-39(40-37(3)38(4)41-39)35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-2/h12-15,18-21,25,27,37-38H,5-11,16-17,22-24,26,28-36H2,1-4H3/b14-12-,15-13-,20-18-,21-19-,27-25- |
| InChIKey | BHKDFDVACGPVEW-VSAYOHKZSA-N |
| XLogP | 12.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.97 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|