C24H34F3NO7 — CID 58069766
[(3R,4S,6R)-3,4,5-trimethyl-6-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl benzoate (PubChem CID 58069766) has the molecular formula C24H34F3NO7 and a molecular weight of 505.53 g/mol. Its IUPAC name is [(3R,4S,6R)-3,4,5-trimethyl-6-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4S,6R)-3,4,5-trimethyl-6-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 58069766 |
| Molecular Formula | C24H34F3NO7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | [(3R,4S,6R)-3,4,5-trimethyl-6-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl benzoate |
| SMILES | CC1[C@H](OCCOCCOCCNC(=O)C(F)(F)F)OC(COC(=O)c2ccccc2)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H34F3NO7/c1-16-17(2)20(15-34-21(29)19-7-5-4-6-8-19)35-22(18(16)3)33-14-13-32-12-11-31-10-9-28-23(30)24(25,26)27/h4-8,16-18,20,22H,9-15H2,1-3H3,(H,28,30)/t16-,17+,18?,20?,22+/m0/s1 |
| InChIKey | VVIFGQBMVOHPMW-SEMIMODFSA-N |
| XLogP | 3.20 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|