C41H74O2 — CID 58069789
(4S)-4-ethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane (PubChem CID 58069789) has the molecular formula C41H74O2 and a molecular weight of 599.04 g/mol. Its IUPAC name is (4S)-4-ethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane.
| Compound Name | (4S)-4-ethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 58069789 |
| Molecular Formula | C41H74O2 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.57 |
| IUPAC Name | (4S)-4-ethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC[C@H](CC)O1 |
| InChI | InChI=1S/C41H74O2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(42-39-40(6-3)43-41)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,40H,4-12,17-18,23-39H2,1-3H3/b15-13-,16-14-,21-19-,22-20-/t40-/m0/s1 |
| InChIKey | SAUQKQYIOKFMDQ-LWOXEAPXSA-N |
| XLogP | 13.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|