C46H85NO2 — CID 58069795
[(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 4-(dimethylamino)cyclohexane-1-carboxylate (PubChem CID 58069795) has the molecular formula C46H85NO2 and a molecular weight of 684.19 g/mol. Its IUPAC name is [(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 4-(dimethylamino)cyclohexane-1-carboxylate.
| Compound Name | [(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 4-(dimethylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58069795 |
| Molecular Formula | C46H85NO2 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 683.66 |
| IUPAC Name | [(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl] 4-(dimethylamino)cyclohexane-1-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)OC(=O)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C46H85NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(49-46(48)43-39-41-44(42-40-43)47(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13,15,19-22,43-45H,5-12,14,16-18,23-42H2,1-4H3/b15-13-,21-19-,22-20- |
| InChIKey | ZJDYTOJICNABTR-YVFFZHSKSA-N |
| XLogP | 14.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|