C33H62O2 — CID 58069849
2-decyl-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane (PubChem CID 58069849) has the molecular formula C33H62O2 and a molecular weight of 490.86 g/mol. Its IUPAC name is 2-decyl-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane.
| Compound Name | 2-decyl-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 58069849 |
| Molecular Formula | C33H62O2 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.47 |
| IUPAC Name | 2-decyl-4,5-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCCCC)OC(C)C(C)O1 |
| InChI | InChI=1S/C33H62O2/c1-5-7-9-11-13-15-16-17-18-19-20-21-22-24-26-28-30-33(34-31(3)32(4)35-33)29-27-25-23-14-12-10-8-6-2/h13,15,17-18,31-32H,5-12,14,16,19-30H2,1-4H3/b15-13-,18-17- |
| InChIKey | LBOMEHQFSKJMEL-SAYPXFITSA-N |
| XLogP | 11.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|