C39H72N2 — CID 58069889
N-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]-N-methylmethanamine (PubChem CID 58069889) has the molecular formula C39H72N2 and a molecular weight of 569.02 g/mol. Its IUPAC name is N-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]-N-methylmethanamine.
| Compound Name | N-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 58069889 |
| Molecular Formula | C39H72N2 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.57 |
| IUPAC Name | N-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]-N-methylmethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)=NN(C)C |
| InChI | InChI=1S/C39H72N2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(40-41(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-38H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | PLLYOWYOBFGLTC-KWXKLSQISA-N |
| XLogP | 13.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|