C38H67N — CID 58069893
(6Z,9Z,28Z,31Z)-19-isocyanoheptatriaconta-6,9,28,31-tetraene (PubChem CID 58069893) has the molecular formula C38H67N and a molecular weight of 537.96 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-isocyanoheptatriaconta-6,9,28,31-tetraene.
| Compound Name | (6Z,9Z,28Z,31Z)-19-isocyanoheptatriaconta-6,9,28,31-tetraene |
|---|---|
| PubChem CID | 58069893 |
| Molecular Formula | C38H67N |
| Molecular Weight | 537.96 g/mol |
| Exact Mass | 537.53 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-isocyanoheptatriaconta-6,9,28,31-tetraene |
| SMILES | [C-]#[N+]C(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C38H67N/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38(39-3)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,38H,4-11,16-17,22-37H2,1-2H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | CNYUIZLNHGWYMK-QYCRHRGJSA-N |
| XLogP | 13.68 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.96 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|