C45H77NO6 — CID 58070025
[(10Z,13Z,32Z,35Z)-5,41-dioxo-1,4-dioxacyclohentetraconta-10,13,32,35-tetraen-23-yl] 4-(dimethylamino)butanoate (PubChem CID 58070025) has the molecular formula C45H77NO6 and a molecular weight of 728.11 g/mol. Its IUPAC name is [(10Z,13Z,32Z,35Z)-5,41-dioxo-1,4-dioxacyclohentetraconta-10,13,32,35-tetraen-23-yl] 4-(dimethylamino)butanoate.
| Compound Name | [(10Z,13Z,32Z,35Z)-5,41-dioxo-1,4-dioxacyclohentetraconta-10,13,32,35-tetraen-23-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 58070025 |
| Molecular Formula | C45H77NO6 |
| Molecular Weight | 728.11 g/mol |
| Exact Mass | 727.58 |
| IUPAC Name | [(10Z,13Z,32Z,35Z)-5,41-dioxo-1,4-dioxacyclohentetraconta-10,13,32,35-tetraen-23-yl] 4-(dimethylamino)butanoate |
| SMILES | CN(C)CCCC(=O)OC1CCCCCCCC/C=C\C/C=C\CCCCC(=O)OCCOC(=O)CCCC/C=C\C/C=C\CCCCCCCC1 |
| InChI | InChI=1S/C45H77NO6/c1-46(2)39-33-38-45(49)52-42-34-29-25-21-17-13-9-5-3-7-11-15-19-23-27-31-36-43(47)50-40-41-51-44(48)37-32-28-24-20-16-12-8-4-6-10-14-18-22-26-30-35-42/h3-4,7-8,15-16,19-20,42H,5-6,9-14,17-18,21-41H2,1-2H3/b7-3-,8-4-,19-15-,20-16- |
| InChIKey | VOMZAVZDWVZPPU-MLJPWCPISA-N |
| XLogP | 11.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.11 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|