C41H75NO6 — CID 58070037
dihexyl (2Z,21Z)-12-[4-(dimethylamino)butanoyloxy]tricosa-2,21-dienedioate (PubChem CID 58070037) has the molecular formula C41H75NO6 and a molecular weight of 678.05 g/mol. Its IUPAC name is dihexyl (2Z,21Z)-12-[4-(dimethylamino)butanoyloxy]tricosa-2,21-dienedioate.
| Compound Name | dihexyl (2Z,21Z)-12-[4-(dimethylamino)butanoyloxy]tricosa-2,21-dienedioate |
|---|---|
| PubChem CID | 58070037 |
| Molecular Formula | C41H75NO6 |
| Molecular Weight | 678.05 g/mol |
| Exact Mass | 677.56 |
| IUPAC Name | dihexyl (2Z,21Z)-12-[4-(dimethylamino)butanoyloxy]tricosa-2,21-dienedioate |
| SMILES | CCCCCCOC(=O)/C=C\CCCCCCCCC(CCCCCCCC/C=C\C(=O)OCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C41H75NO6/c1-5-7-9-27-36-46-39(43)32-25-21-17-13-11-15-19-23-30-38(48-41(45)34-29-35-42(3)4)31-24-20-16-12-14-18-22-26-33-40(44)47-37-28-10-8-6-2/h25-26,32-33,38H,5-24,27-31,34-37H2,1-4H3/b32-25-,33-26- |
| InChIKey | ZTNKKBBADJYZQZ-MKHSXDCDSA-N |
| XLogP | 10.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.05 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|