About 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium
8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium (PubChem CID 58070076) has the molecular formula C29H36O2P+
and a molecular weight of 447.58 g/mol. Its IUPAC name is 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium.
Molecular Properties
| Compound Name | 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium |
| PubChem CID | 58070076 |
| Molecular Formula | C29H36O2P+ |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium |
| SMILES | c1ccc([P+](CCCCCCCCC2OCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H36O2P/c1(3-14-22-29-30-23-24-31-29)2-4-15-25-32(26-16-8-5-9-17-26,27-18-10-6-11-19-27)28-20-12-7-13-21-28/h5-13,16-21,29H,1-4,14-15,22-25H2/q+1 |
| InChIKey | IAXKMYYJJFFQEY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium?
The IUPAC name of 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium (CID 58070076) is 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium.
What is the SMILES notation for 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium?
The canonical SMILES for 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium is c1ccc([P+](CCCCCCCCC2OCCO2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium?
The InChIKey is IAXKMYYJJFFQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36O2P/c1(3-14-22-29-30-23-24-31-29)2-4-15-25-32(26-16-8-5-9-17-26,27-18-10-6-11-19-27)28-20-12-7-13-21-28/h5-13,16-21,29H,1-4,14-15,22-25H2/q+1.
What are the key properties of 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium?
8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium has a molecular weight of 447.58 g/mol, XLogP of 6.08, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,3-dioxolan-2-yl)octyl-triphenylphosphanium is sourced from PubChem (CID 58070076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).