C41H71NO6 — CID 58070096
[9-[4-(dimethylamino)butanoyloxy]-17-[(2Z,5Z)-nona-2,5-dienoyl]oxyheptadecyl] (2Z,5Z)-nona-2,5-dienoate (PubChem CID 58070096) has the molecular formula C41H71NO6 and a molecular weight of 674.02 g/mol. Its IUPAC name is [9-[4-(dimethylamino)butanoyloxy]-17-[(2Z,5Z)-nona-2,5-dienoyl]oxyheptadecyl] (2Z,5Z)-nona-2,5-dienoate.
| Compound Name | [9-[4-(dimethylamino)butanoyloxy]-17-[(2Z,5Z)-nona-2,5-dienoyl]oxyheptadecyl] (2Z,5Z)-nona-2,5-dienoate |
|---|---|
| PubChem CID | 58070096 |
| Molecular Formula | C41H71NO6 |
| Molecular Weight | 674.02 g/mol |
| Exact Mass | 673.53 |
| IUPAC Name | [9-[4-(dimethylamino)butanoyloxy]-17-[(2Z,5Z)-nona-2,5-dienoyl]oxyheptadecyl] (2Z,5Z)-nona-2,5-dienoate |
| SMILES | CCC/C=C\C/C=C\C(=O)OCCCCCCCCC(CCCCCCCCOC(=O)/C=C\C/C=C\CCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C41H71NO6/c1-5-7-9-11-19-25-32-39(43)46-36-27-21-15-13-17-23-30-38(48-41(45)34-29-35-42(3)4)31-24-18-14-16-22-28-37-47-40(44)33-26-20-12-10-8-6-2/h9-12,25-26,32-33,38H,5-8,13-24,27-31,34-37H2,1-4H3/b11-9-,12-10-,32-25-,33-26- |
| InChIKey | NPSVUHDCOMVQBH-CDHJQBNYSA-N |
| XLogP | 10.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.02 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|