About bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate
bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate (PubChem CID 58070111) has the molecular formula C42H78N2O5
and a molecular weight of 691.09 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate.
Molecular Properties
| Compound Name | bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate |
| PubChem CID | 58070111 |
| Molecular Formula | C42H78N2O5 |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.59 |
| IUPAC Name | bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C\CCCCCC)CC(=O)NCCCN(C)C |
| InChI | InChI=1S/C42H78N2O5/c1-5-7-9-11-13-21-27-36-48-41(46)32-25-19-15-17-23-30-39(38-40(45)43-34-29-35-44(3)4)31-24-18-16-20-26-33-42(47)49-37-28-22-14-12-10-8-6-2/h21-22,27-28,39H,5-20,23-26,29-38H2,1-4H3,(H,43,45)/b27-21-,28-22- |
| InChIKey | LKZPIZMQFGKMAS-ZDSKVHJSSA-N |
| XLogP | 10.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate?
The IUPAC name of bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate (CID 58070111) is bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate.
What is the SMILES notation for bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate?
The canonical SMILES for bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate is CCCCCC/C=C\COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C\CCCCCC)CC(=O)NCCCN(C)C.
What is the InChIKey of bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate?
The InChIKey is LKZPIZMQFGKMAS-ZDSKVHJSSA-N. The full InChI is InChI=1S/C42H78N2O5/c1-5-7-9-11-13-21-27-36-48-41(46)32-25-19-15-17-23-30-39(38-40(45)43-34-29-35-44(3)4)31-24-18-16-20-26-33-42(47)49-37-28-22-14-12-10-8-6-2/h21-22,27-28,39H,5-20,23-26,29-38H2,1-4H3,(H,43,45)/b27-21-,28-22-.
What are the key properties of bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate?
bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate has a molecular weight of 691.09 g/mol, XLogP of 10.66, 36 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(Z)-non-2-enyl] 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate is sourced from PubChem (CID 58070111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).