C13H17NO2 — CID 58070207
(E,2S,3R)-2-(benzylideneamino)hex-4-ene-1,3-diol (PubChem CID 58070207) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (E,2S,3R)-2-(benzylideneamino)hex-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-(benzylideneamino)hex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 58070207 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (E,2S,3R)-2-(benzylideneamino)hex-4-ene-1,3-diol |
| SMILES | C/C=C/[C@@H](O)[C@H](CO)/N=C/c1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c1-2-6-13(16)12(10-15)14-9-11-7-4-3-5-8-11/h2-9,12-13,15-16H,10H2,1H3/b6-2+,14-9+/t12-,13+/m0/s1 |
| InChIKey | BSZQZCIQAGBLID-CYMDZLQASA-N |
| XLogP | 1.40 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|