C23H42BNO4Si — CID 58070492
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[1-tri(propan-2-yl)silyloxypropan-2-yl]pyridin-2-one (PubChem CID 58070492) has the molecular formula C23H42BNO4Si and a molecular weight of 435.49 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[1-tri(propan-2-yl)silyloxypropan-2-yl]pyridin-2-one.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[1-tri(propan-2-yl)silyloxypropan-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 58070492 |
| Molecular Formula | C23H42BNO4Si |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[1-tri(propan-2-yl)silyloxypropan-2-yl]pyridin-2-one |
| SMILES | CC(CO[Si](C(C)C)(C(C)C)C(C)C)n1cc(B2OC(C)(C)C(C)(C)O2)ccc1=O |
| InChI | InChI=1S/C23H42BNO4Si/c1-16(2)30(17(3)4,18(5)6)27-15-19(7)25-14-20(12-13-21(25)26)24-28-22(8,9)23(10,11)29-24/h12-14,16-19H,15H2,1-11H3 |
| InChIKey | PWVLMMOFPBALAW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|