About 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate
2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate (PubChem CID 58070526) has the molecular formula C10H19NO8S
and a molecular weight of 313.33 g/mol. Its IUPAC name is 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate.
Molecular Properties
| Compound Name | 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate |
| PubChem CID | 58070526 |
| Molecular Formula | C10H19NO8S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate |
| SMILES | COCC(COC(=O)CC(C(C)=O)S(=O)(=O)ON)OC |
| InChI | InChI=1S/C10H19NO8S/c1-7(12)9(20(14,15)19-11)4-10(13)18-6-8(17-3)5-16-2/h8-9H,4-6,11H2,1-3H3 |
| InChIKey | JKJAWKLVZUIQPB-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate?
The IUPAC name of 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate (CID 58070526) is 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate.
What is the SMILES notation for 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate?
The canonical SMILES for 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate is COCC(COC(=O)CC(C(C)=O)S(=O)(=O)ON)OC.
What is the InChIKey of 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate?
The InChIKey is JKJAWKLVZUIQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO8S/c1-7(12)9(20(14,15)19-11)4-10(13)18-6-8(17-3)5-16-2/h8-9H,4-6,11H2,1-3H3.
What are the key properties of 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate?
2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate has a molecular weight of 313.33 g/mol, XLogP of -1.24, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxypropyl 3-aminooxysulfonyl-4-oxopentanoate is sourced from PubChem (CID 58070526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).