C16H22F6O4 — CID 58070632
[2,4-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 58070632) has the molecular formula C16H22F6O4 and a molecular weight of 392.34 g/mol. Its IUPAC name is [2,4-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2,4-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58070632 |
| Molecular Formula | C16H22F6O4 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [2,4-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(C(C)(O)C(F)(F)F)CC1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C16H22F6O4/c1-8(2)12(23)26-11-6-5-9(13(3,24)15(17,18)19)7-10(11)14(4,25)16(20,21)22/h9-11,24-25H,1,5-7H2,2-4H3 |
| InChIKey | DPGYFYFRQUNTQN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|