About [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate
[1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate (PubChem CID 58070662) has the molecular formula C27H32N2O5
and a molecular weight of 464.56 g/mol. Its IUPAC name is [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate.
Molecular Properties
| Compound Name | [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate |
| PubChem CID | 58070662 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate |
| SMILES | CCC(C)c1ccc2cc3ccc(C(=O)OC4CN(COC)C(=O)N(COC)C4)cc3cc2c1 |
| InChI | InChI=1S/C27H32N2O5/c1-5-18(2)19-6-7-20-11-21-8-9-22(12-24(21)13-23(20)10-19)26(30)34-25-14-28(16-32-3)27(31)29(15-25)17-33-4/h6-13,18,25H,5,14-17H2,1-4H3 |
| InChIKey | ZSLFAPYWCPVYRR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate?
The IUPAC name of [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate (CID 58070662) is [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate.
What is the SMILES notation for [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate?
The canonical SMILES for [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate is CCC(C)c1ccc2cc3ccc(C(=O)OC4CN(COC)C(=O)N(COC)C4)cc3cc2c1.
What is the InChIKey of [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate?
The InChIKey is ZSLFAPYWCPVYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N2O5/c1-5-18(2)19-6-7-20-11-21-8-9-22(12-24(21)13-23(20)10-19)26(30)34-25-14-28(16-32-3)27(31)29(15-25)17-33-4/h6-13,18,25H,5,14-17H2,1-4H3.
What are the key properties of [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate?
[1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate has a molecular weight of 464.56 g/mol, XLogP of 4.98, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl] 7-butan-2-ylanthracene-2-carboxylate is sourced from PubChem (CID 58070662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).