About 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene
7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene (PubChem CID 58070779) has the molecular formula C12H20N3+
and a molecular weight of 206.31 g/mol. Its IUPAC name is 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene.
Molecular Properties
| Compound Name | 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene |
| PubChem CID | 58070779 |
| Molecular Formula | C12H20N3+ |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene |
| SMILES | C1CCCc2c(nn3[n+]2CCCC3)CC1 |
| InChI | InChI=1S/C12H20N3/c1-2-4-8-12-11(7-3-1)13-15-10-6-5-9-14(12)15/h1-10H2/q+1 |
| InChIKey | XESKQNLOQMYZDM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene?
The IUPAC name of 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene (CID 58070779) is 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene.
What is the SMILES notation for 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene?
The canonical SMILES for 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene is C1CCCc2c(nn3[n+]2CCCC3)CC1.
What is the InChIKey of 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene?
The InChIKey is XESKQNLOQMYZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N3/c1-2-4-8-12-11(7-3-1)13-15-10-6-5-9-14(12)15/h1-10H2/q+1.
What are the key properties of 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene?
7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene has a molecular weight of 206.31 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diaza-2-azoniatricyclo[7.6.0.02,7]pentadeca-1,8-diene is sourced from PubChem (CID 58070779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).