C11H16F2N3+ — CID 58070784
14,14-difluoro-6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene (PubChem CID 58070784) has the molecular formula C11H16F2N3+ and a molecular weight of 228.27 g/mol. Its IUPAC name is 14,14-difluoro-6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene.
| Compound Name | 14,14-difluoro-6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene |
|---|---|
| PubChem CID | 58070784 |
| Molecular Formula | C11H16F2N3+ |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 14,14-difluoro-6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene |
| SMILES | FC1(F)CCCCCc2nn3[n+](c21)CCC3 |
| InChI | InChI=1S/C11H16F2N3/c12-11(13)6-3-1-2-5-9-10(11)15-7-4-8-16(15)14-9/h1-8H2/q+1 |
| InChIKey | WWTWVKAGOQPJAW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|