About 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene
8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene (PubChem CID 58070787) has the molecular formula C13H22N3+
and a molecular weight of 220.34 g/mol. Its IUPAC name is 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene.
Molecular Properties
| Compound Name | 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene |
| PubChem CID | 58070787 |
| Molecular Formula | C13H22N3+ |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene |
| SMILES | C1CCCc2c(nn3[n+]2CCCCC3)CC1 |
| InChI | InChI=1S/C13H22N3/c1-2-5-9-13-12(8-4-1)14-16-11-7-3-6-10-15(13)16/h1-11H2/q+1 |
| InChIKey | PTQOFVVTKCDTDU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene?
The IUPAC name of 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene (CID 58070787) is 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene.
What is the SMILES notation for 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene?
The canonical SMILES for 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene is C1CCCc2c(nn3[n+]2CCCCC3)CC1.
What is the InChIKey of 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene?
The InChIKey is PTQOFVVTKCDTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N3/c1-2-5-9-13-12(8-4-1)14-16-11-7-3-6-10-15(13)16/h1-11H2/q+1.
What are the key properties of 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene?
8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene has a molecular weight of 220.34 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-diaza-2-azoniatricyclo[8.6.0.02,8]hexadeca-1,9-diene is sourced from PubChem (CID 58070787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).