C25H21ClN2O4 — CID 58070849
(1R,2R,6S,7S)-4-[4-(6-chloroquinoxalin-2-yl)oxy-2,6-dimethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 58070849) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[4-(6-chloroquinoxalin-2-yl)oxy-2,6-dimethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1R,2R,6S,7S)-4-[4-(6-chloroquinoxalin-2-yl)oxy-2,6-dimethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 58070849 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (1R,2R,6S,7S)-4-[4-(6-chloroquinoxalin-2-yl)oxy-2,6-dimethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | Cc1cc(Oc2cnc3cc(Cl)ccc3n2)cc(C)c1C1=C(O)[C@H]2[C@@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C25H21ClN2O4/c1-11-7-14(31-19-10-27-16-9-13(26)3-4-15(16)28-19)8-12(2)20(11)23-24(29)21-17-5-6-18(32-17)22(21)25(23)30/h3-4,7-10,17-18,21-22,29H,5-6H2,1-2H3/t17-,18+,21+,22-/m0/s1 |
| InChIKey | KMRSITNRTODZMK-KKXYHZGYSA-N |
| XLogP | 5.34 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |