C18H20O3 — CID 58070878
(1S,2R,6S,7R)-5-hydroxy-4-(4-hydroxy-2,6-dimethylphenyl)tricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 58070878) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-hydroxy-4-(4-hydroxy-2,6-dimethylphenyl)tricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1S,2R,6S,7R)-5-hydroxy-4-(4-hydroxy-2,6-dimethylphenyl)tricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 58070878 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1S,2R,6S,7R)-5-hydroxy-4-(4-hydroxy-2,6-dimethylphenyl)tricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | Cc1cc(O)cc(C)c1C1=C(O)[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2C1=O |
| InChI | InChI=1S/C18H20O3/c1-8-5-12(19)6-9(2)13(8)16-17(20)14-10-3-4-11(7-10)15(14)18(16)21/h5-6,10-11,14-15,19-20H,3-4,7H2,1-2H3/t10-,11+,14+,15-/m1/s1 |
| InChIKey | VCPAMAZIPSTEHK-FDRIWYBQSA-N |
| XLogP | 3.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |