About (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid
(2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid (PubChem CID 58071240) has the molecular formula C7H12N2O4S
and a molecular weight of 220.25 g/mol. Its IUPAC name is (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid |
| PubChem CID | 58071240 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid |
| SMILES | N[C@@H](CSCC1CNC(=O)O1)C(=O)O |
| InChI | InChI=1S/C7H12N2O4S/c8-5(6(10)11)3-14-2-4-1-9-7(12)13-4/h4-5H,1-3,8H2,(H,9,12)(H,10,11)/t4?,5-/m0/s1 |
| InChIKey | VCSZGJAJAQCEIU-AKGZTFGVSA-N |
| XLogP | -0.76 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid?
The IUPAC name of (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid (CID 58071240) is (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid?
The canonical SMILES for (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid is N[C@@H](CSCC1CNC(=O)O1)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid?
The InChIKey is VCSZGJAJAQCEIU-AKGZTFGVSA-N. The full InChI is InChI=1S/C7H12N2O4S/c8-5(6(10)11)3-14-2-4-1-9-7(12)13-4/h4-5H,1-3,8H2,(H,9,12)(H,10,11)/t4?,5-/m0/s1.
What are the key properties of (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid?
(2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid has a molecular weight of 220.25 g/mol, XLogP of -0.76, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-[(2-oxo-1,3-oxazolidin-5-yl)methylsulfanyl]propanoic acid is sourced from PubChem (CID 58071240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).