C12H7BrF2N2O4 — CID 58072325
1-(4-bromo-2,5-difluorophenyl)-5-methoxy-4-oxopyridazine-3-carboxylic acid (PubChem CID 58072325) has the molecular formula C12H7BrF2N2O4 and a molecular weight of 361.10 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-5-methoxy-4-oxopyridazine-3-carboxylic acid.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-5-methoxy-4-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 58072325 |
| Molecular Formula | C12H7BrF2N2O4 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-5-methoxy-4-oxopyridazine-3-carboxylic acid |
| SMILES | COc1cn(-c2cc(F)c(Br)cc2F)nc(C(=O)O)c1=O |
| InChI | InChI=1S/C12H7BrF2N2O4/c1-21-9-4-17(16-10(11(9)18)12(19)20)8-3-6(14)5(13)2-7(8)15/h2-4H,1H3,(H,19,20) |
| InChIKey | BVWWMVXHAOQGRC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|