C23H20FN3O2 — CID 58072636
4-[6-ethyl-5-[2-(6-propyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-fluorobenzoic acid (PubChem CID 58072636) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is 4-[6-ethyl-5-[2-(6-propyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[6-ethyl-5-[2-(6-propyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 58072636 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-[6-ethyl-5-[2-(6-propyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-fluorobenzoic acid |
| SMILES | CCCc1ccc(C#Cc2c(CC)ncnc2-c2ccc(C(=O)O)c(F)c2)cn1 |
| InChI | InChI=1S/C23H20FN3O2/c1-3-5-17-9-6-15(13-25-17)7-10-19-21(4-2)26-14-27-22(19)16-8-11-18(23(28)29)20(24)12-16/h6,8-9,11-14H,3-5H2,1-2H3,(H,28,29) |
| InChIKey | BRFNFZROEJXQHY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|