C27H30N6O — CID 58072649
[4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]phenyl]-(4-butylpiperazin-1-yl)methanone (PubChem CID 58072649) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is [4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]phenyl]-(4-butylpiperazin-1-yl)methanone.
| Compound Name | [4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]phenyl]-(4-butylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 58072649 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]phenyl]-(4-butylpiperazin-1-yl)methanone |
| SMILES | CCCCN1CCN(C(=O)c2ccc(-c3ncnc(C)c3C#Cc3ccc(N)nc3)cc2)CC1 |
| InChI | InChI=1S/C27H30N6O/c1-3-4-13-32-14-16-33(17-15-32)27(34)23-9-7-22(8-10-23)26-24(20(2)30-19-31-26)11-5-21-6-12-25(28)29-18-21/h6-10,12,18-19H,3-4,13-17H2,1-2H3,(H2,28,29) |
| InChIKey | VMWIOSJZNCHWFQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|