About methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate
methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate (PubChem CID 58072695) has the molecular formula C21H16Cl2N4O2
and a molecular weight of 427.29 g/mol. Its IUPAC name is methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate.
Molecular Properties
| Compound Name | methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate |
| PubChem CID | 58072695 |
| Molecular Formula | C21H16Cl2N4O2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate |
| SMILES | CCc1ncnc(-c2cc(Cl)c(C(=O)OC)c(Cl)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C21H16Cl2N4O2/c1-3-17-14(6-4-12-5-7-18(24)25-10-12)20(27-11-26-17)13-8-15(22)19(16(23)9-13)21(28)29-2/h5,7-11H,3H2,1-2H3,(H2,24,25) |
| InChIKey | HHFZYWLWDALZCY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate?
The IUPAC name of methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate (CID 58072695) is methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate.
What is the SMILES notation for methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate?
The canonical SMILES for methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate is CCc1ncnc(-c2cc(Cl)c(C(=O)OC)c(Cl)c2)c1C#Cc1ccc(N)nc1.
What is the InChIKey of methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate?
The InChIKey is HHFZYWLWDALZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Cl2N4O2/c1-3-17-14(6-4-12-5-7-18(24)25-10-12)20(27-11-26-17)13-8-15(22)19(16(23)9-13)21(28)29-2/h5,7-11H,3H2,1-2H3,(H2,24,25).
What are the key properties of methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate?
methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate has a molecular weight of 427.29 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2,6-dichlorobenzoate is sourced from PubChem (CID 58072695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).