C29H31FN6O — CID 58072712
[4-[5-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone (PubChem CID 58072712) has the molecular formula C29H31FN6O and a molecular weight of 498.61 g/mol. Its IUPAC name is [4-[5-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | [4-[5-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 58072712 |
| Molecular Formula | C29H31FN6O |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [4-[5-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CCc1ncnc(-c2ccc(C(=O)N3CCN4CCCCC4C3)c(F)c2)c1C#Cc1ccc(N)nc1C |
| InChI | InChI=1S/C29H31FN6O/c1-3-26-24(11-7-20-9-12-27(31)34-19(20)2)28(33-18-32-26)21-8-10-23(25(30)16-21)29(37)36-15-14-35-13-5-4-6-22(35)17-36/h8-10,12,16,18,22H,3-6,13-15,17H2,1-2H3,(H2,31,34) |
| InChIKey | LYSNNTWSYQSRTD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|