C24H20F3N3O2 — CID 58072714
methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-(trifluoromethyl)benzoate (PubChem CID 58072714) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 58072714 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2-(trifluoromethyl)benzoate |
| SMILES | CCc1ccc(C#Cc2c(CC)ncnc2-c2ccc(C(=O)OC)c(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C24H20F3N3O2/c1-4-17-9-6-15(13-28-17)7-10-19-21(5-2)29-14-30-22(19)16-8-11-18(23(31)32-3)20(12-16)24(25,26)27/h6,8-9,11-14H,4-5H2,1-3H3 |
| InChIKey | ZHHIXCHEULBICJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|