C25H24FN5O3S — CID 58072848
4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzamide (PubChem CID 58072848) has the molecular formula C25H24FN5O3S and a molecular weight of 493.56 g/mol. Its IUPAC name is 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzamide.
| Compound Name | 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 58072848 |
| Molecular Formula | C25H24FN5O3S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzamide |
| SMILES | CCc1ncnc(-c2ccc(C(=O)N(C)C3CCS(=O)(=O)C3)c(F)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C25H24FN5O3S/c1-3-22-20(7-4-16-5-9-23(27)28-13-16)24(30-15-29-22)17-6-8-19(21(26)12-17)25(32)31(2)18-10-11-35(33,34)14-18/h5-6,8-9,12-13,15,18H,3,10-11,14H2,1-2H3,(H2,27,28) |
| InChIKey | YPCCVXJXZXZPEQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|