C24H22FN5O3S — CID 58073034
4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide (PubChem CID 58073034) has the molecular formula C24H22FN5O3S and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide.
| Compound Name | 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 58073034 |
| Molecular Formula | C24H22FN5O3S |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide |
| SMILES | CCc1ncnc(-c2ccc(C(=O)NC3CCS(=O)(=O)C3)c(F)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C24H22FN5O3S/c1-2-21-19(6-3-15-4-8-22(26)27-12-15)23(29-14-28-21)16-5-7-18(20(25)11-16)24(31)30-17-9-10-34(32,33)13-17/h4-5,7-8,11-12,14,17H,2,9-10,13H2,1H3,(H2,26,27)(H,30,31) |
| InChIKey | XUXFQNOITDLBBL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|