C26H27N5O3S — CID 58073091
4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide (PubChem CID 58073091) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide.
| Compound Name | 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 58073091 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide |
| SMILES | CCc1ncnc(-c2ccc(C(=O)N(C)C3CCS(=O)(=O)C3)c(C)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C26H27N5O3S/c1-4-23-22(8-5-18-6-10-24(27)28-14-18)25(30-16-29-23)19-7-9-21(17(2)13-19)26(32)31(3)20-11-12-35(33,34)15-20/h6-7,9-10,13-14,16,20H,4,11-12,15H2,1-3H3,(H2,27,28) |
| InChIKey | BPKWXBSQPKUOLV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|