About N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+)
N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) (PubChem CID 58073164) has the molecular formula C11H24NY
and a molecular weight of 259.23 g/mol. Its IUPAC name is N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+).
Molecular Properties
| Compound Name | N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) |
| PubChem CID | 58073164 |
| Molecular Formula | C11H24NY |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) |
| SMILES | C[C-](C)C.[CH2-]CN([CH2-])C(C)(C)C.[Y+3] |
| InChI | InChI=1S/C7H15N.C4H9.Y/c1-6-8(5)7(2,3)4;1-4(2)3;/h1,5-6H2,2-4H3;1-3H3;/q-2;-1;+3 |
| InChIKey | YISXYGHGNRIEPA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+)?
The IUPAC name of N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) (CID 58073164) is N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+).
What is the SMILES notation for N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+)?
The canonical SMILES for N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) is C[C-](C)C.[CH2-]CN([CH2-])C(C)(C)C.[Y+3].
What is the InChIKey of N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+)?
The InChIKey is YISXYGHGNRIEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C4H9.Y/c1-6-8(5)7(2,3)4;1-4(2)3;/h1,5-6H2,2-4H3;1-3H3;/q-2;-1;+3.
What are the key properties of N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+)?
N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) has a molecular weight of 259.23 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methanidyl-2-methylpropan-2-amine;2-methylpropane;yttrium(3+) is sourced from PubChem (CID 58073164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).